C28H27ClN4O6S — CID 124745299
(1R,9S,13S)-N-(4-chlorophenyl)-10-[2-(3,4-dimethoxyphenyl)ethyl]-9-methyl-4-nitro-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide (PubChem CID 124745299) has the molecular formula C28H27ClN4O6S and a molecular weight of 583.07 g/mol. Its IUPAC name is (1R,9S,13S)-N-(4-chlorophenyl)-10-[2-(3,4-dimethoxyphenyl)ethyl]-9-methyl-4-nitro-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide.
| Compound Name | (1R,9S,13S)-N-(4-chlorophenyl)-10-[2-(3,4-dimethoxyphenyl)ethyl]-9-methyl-4-nitro-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
|---|---|
| PubChem CID | 124745299 |
| Molecular Formula | C28H27ClN4O6S |
| Molecular Weight | 583.07 g/mol |
| Exact Mass | 582.13 |
| IUPAC Name | (1R,9S,13S)-N-(4-chlorophenyl)-10-[2-(3,4-dimethoxyphenyl)ethyl]-9-methyl-4-nitro-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
| SMILES | COc1ccc(CCN2C(=S)N[C@H]3c4cc([N+](=O)[O-])ccc4O[C@@]2(C)[C@H]3C(=O)Nc2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C28H27ClN4O6S/c1-28-24(26(34)30-18-7-5-17(29)6-8-18)25(20-15-19(33(35)36)9-11-21(20)39-28)31-27(40)32(28)13-12-16-4-10-22(37-2)23(14-16)38-3/h4-11,14-15,24-25H,12-13H2,1-3H3,(H,30,34)(H,31,40)/t24-,25+,28+/m1/s1 |
| InChIKey | FGEUSVGQDDTBPD-QQNWGBJXSA-N |
| XLogP | 5.10 |
| TPSA | 115.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.07 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|