C24H19F5O8 — CID 95397912
2-methoxyethyl 3-[4-methyl-2-oxo-7-[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]oxychromen-6-yl]propanoate (PubChem CID 95397912) has the molecular formula C24H19F5O8 and a molecular weight of 530.40 g/mol. Its IUPAC name is 2-methoxyethyl 3-[4-methyl-2-oxo-7-[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]oxychromen-6-yl]propanoate.
| Compound Name | 2-methoxyethyl 3-[4-methyl-2-oxo-7-[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]oxychromen-6-yl]propanoate |
|---|---|
| PubChem CID | 95397912 |
| Molecular Formula | C24H19F5O8 |
| Molecular Weight | 530.40 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | 2-methoxyethyl 3-[4-methyl-2-oxo-7-[2-(2,3,4,5,6-pentafluorophenoxy)acetyl]oxychromen-6-yl]propanoate |
| SMILES | COCCOC(=O)CCc1cc2c(C)cc(=O)oc2cc1OC(=O)COc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C24H19F5O8/c1-11-7-17(31)37-15-9-14(12(8-13(11)15)3-4-16(30)34-6-5-33-2)36-18(32)10-35-24-22(28)20(26)19(25)21(27)23(24)29/h7-9H,3-6,10H2,1-2H3 |
| InChIKey | NIQYSNKXSVTNEM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 101.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|