C22H40O5P2 — CID 95401005
methyl-[methyl-[(2E,6Z,10Z)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]phosphoryl]oxyphosphinic acid (PubChem CID 95401005) has the molecular formula C22H40O5P2 and a molecular weight of 446.51 g/mol. Its IUPAC name is methyl-[methyl-[(2E,6Z,10Z)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]phosphoryl]oxyphosphinic acid.
| Compound Name | methyl-[methyl-[(2E,6Z,10Z)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]phosphoryl]oxyphosphinic acid |
|---|---|
| PubChem CID | 95401005 |
| Molecular Formula | C22H40O5P2 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | methyl-[methyl-[(2E,6Z,10Z)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenoxy]phosphoryl]oxyphosphinic acid |
| SMILES | CC(C)=CCC/C(C)=C\CC/C(C)=C\CC/C(C)=C/CO[P@@](C)(=O)OP(C)(=O)O |
| InChI | InChI=1S/C22H40O5P2/c1-19(2)11-8-12-20(3)13-9-14-21(4)15-10-16-22(5)17-18-26-29(7,25)27-28(6,23)24/h11,13,15,17H,8-10,12,14,16,18H2,1-7H3,(H,23,24)/b20-13-,21-15-,22-17+/t29-/m1/s1 |
| InChIKey | NNNJMOLVDKLYQL-PYGSTSJCSA-N |
| XLogP | 7.80 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|