C22H16O3S — CID 95401076
7-methoxy-4-phenyl-3-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)chromen-2-one (PubChem CID 95401076) has the molecular formula C22H16O3S and a molecular weight of 360.43 g/mol. Its IUPAC name is 7-methoxy-4-phenyl-3-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)chromen-2-one.
| Compound Name | 7-methoxy-4-phenyl-3-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)chromen-2-one |
|---|---|
| PubChem CID | 95401076 |
| Molecular Formula | C22H16O3S |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | 7-methoxy-4-phenyl-3-(6-sulfanylidenecyclohexa-1,3-dien-1-yl)chromen-2-one |
| SMILES | COc1ccc2c(-c3ccccc3)c(C3=CC=CCC3=S)c(=O)oc2c1 |
| InChI | InChI=1S/C22H16O3S/c1-24-15-11-12-16-18(13-15)25-22(23)21(17-9-5-6-10-19(17)26)20(16)14-7-3-2-4-8-14/h2-9,11-13H,10H2,1H3 |
| InChIKey | DVPOLRVADSVKRL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|