C16H20O4 — CID 95479033
(Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-5,5-dimethylhex-2-enoic acid (PubChem CID 95479033) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is (Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-5,5-dimethylhex-2-enoic acid.
| Compound Name | (Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-5,5-dimethylhex-2-enoic acid |
|---|---|
| PubChem CID | 95479033 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-5,5-dimethylhex-2-enoic acid |
| SMILES | CC(C)(C)C/C(=C/C(=O)O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H20O4/c1-16(2,3)10-12(9-15(17)18)11-4-5-13-14(8-11)20-7-6-19-13/h4-5,8-9H,6-7,10H2,1-3H3,(H,17,18)/b12-9- |
| InChIKey | YHFPHVKMUYGPBO-XFXZXTDPSA-N |
| XLogP | 3.36 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|