C9H14BrNO2S2 — CID 95505346
N-[2-(5-bromothiophen-2-yl)sulfonylethyl]propan-2-amine (PubChem CID 95505346) has the molecular formula C9H14BrNO2S2 and a molecular weight of 312.25 g/mol. Its IUPAC name is N-[2-(5-bromothiophen-2-yl)sulfonylethyl]propan-2-amine.
| Compound Name | N-[2-(5-bromothiophen-2-yl)sulfonylethyl]propan-2-amine |
|---|---|
| PubChem CID | 95505346 |
| Molecular Formula | C9H14BrNO2S2 |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 310.96 |
| IUPAC Name | N-[2-(5-bromothiophen-2-yl)sulfonylethyl]propan-2-amine |
| SMILES | CC(C)NCCS(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C9H14BrNO2S2/c1-7(2)11-5-6-15(12,13)9-4-3-8(10)14-9/h3-4,7,11H,5-6H2,1-2H3 |
| InChIKey | OBEZACVAXVCWHJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |