C16H14ClN3S — CID 95507130
4-chloro-5-(4-methylphenyl)-N-prop-2-enylthieno[2,3-d]pyrimidin-2-amine (PubChem CID 95507130) has the molecular formula C16H14ClN3S and a molecular weight of 315.83 g/mol. Its IUPAC name is 4-chloro-5-(4-methylphenyl)-N-prop-2-enylthieno[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-chloro-5-(4-methylphenyl)-N-prop-2-enylthieno[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 95507130 |
| Molecular Formula | C16H14ClN3S |
| Molecular Weight | 315.83 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 4-chloro-5-(4-methylphenyl)-N-prop-2-enylthieno[2,3-d]pyrimidin-2-amine |
| SMILES | C=CCNc1nc(Cl)c2c(-c3ccc(C)cc3)csc2n1 |
| InChI | InChI=1S/C16H14ClN3S/c1-3-8-18-16-19-14(17)13-12(9-21-15(13)20-16)11-6-4-10(2)5-7-11/h3-7,9H,1,8H2,2H3,(H,18,19,20) |
| InChIKey | QUUSTIMXTSOGAX-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.83 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|