C18H18ClN3S — CID 82066483
2-chloro-6-ethyl-5-(4-methylphenyl)-N-prop-2-enylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 82066483) has the molecular formula C18H18ClN3S and a molecular weight of 343.88 g/mol. Its IUPAC name is 2-chloro-6-ethyl-5-(4-methylphenyl)-N-prop-2-enylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-chloro-6-ethyl-5-(4-methylphenyl)-N-prop-2-enylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 82066483 |
| Molecular Formula | C18H18ClN3S |
| Molecular Weight | 343.88 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 2-chloro-6-ethyl-5-(4-methylphenyl)-N-prop-2-enylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | C=CCNc1nc(Cl)nc2sc(CC)c(-c3ccc(C)cc3)c12 |
| InChI | InChI=1S/C18H18ClN3S/c1-4-10-20-16-15-14(12-8-6-11(3)7-9-12)13(5-2)23-17(15)22-18(19)21-16/h4,6-9H,1,5,10H2,2-3H3,(H,20,21,22) |
| InChIKey | ISBNXMWIQYUHOU-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.88 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|