C19H30N2O3S — CID 95525245
4-[[(2R)-2-(cyclohexylmethyl)morpholin-4-yl]methyl]-N-methylbenzenesulfonamide (PubChem CID 95525245) has the molecular formula C19H30N2O3S and a molecular weight of 366.53 g/mol. Its IUPAC name is 4-[[(2R)-2-(cyclohexylmethyl)morpholin-4-yl]methyl]-N-methylbenzenesulfonamide.
| Compound Name | 4-[[(2R)-2-(cyclohexylmethyl)morpholin-4-yl]methyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 95525245 |
| Molecular Formula | C19H30N2O3S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 4-[[(2R)-2-(cyclohexylmethyl)morpholin-4-yl]methyl]-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(CN2CCO[C@H](CC3CCCCC3)C2)cc1 |
| InChI | InChI=1S/C19H30N2O3S/c1-20-25(22,23)19-9-7-17(8-10-19)14-21-11-12-24-18(15-21)13-16-5-3-2-4-6-16/h7-10,16,18,20H,2-6,11-15H2,1H3/t18-/m1/s1 |
| InChIKey | IXQGBTFCIHIGTO-GOSISDBHSA-N |
| XLogP | 2.77 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |