C11H11F3N2O3 — CID 95525298
2-[(2R)-2-(trifluoromethyl)morpholin-4-yl]pyridine-3-carboxylic acid (PubChem CID 95525298) has the molecular formula C11H11F3N2O3 and a molecular weight of 276.21 g/mol. Its IUPAC name is 2-[(2R)-2-(trifluoromethyl)morpholin-4-yl]pyridine-3-carboxylic acid.
| Compound Name | 2-[(2R)-2-(trifluoromethyl)morpholin-4-yl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 95525298 |
| Molecular Formula | C11H11F3N2O3 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2-[(2R)-2-(trifluoromethyl)morpholin-4-yl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cccnc1N1CCO[C@@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C11H11F3N2O3/c12-11(13,14)8-6-16(4-5-19-8)9-7(10(17)18)2-1-3-15-9/h1-3,8H,4-6H2,(H,17,18)/t8-/m1/s1 |
| InChIKey | PQDKBGGBEPWGAB-MRVPVSSYSA-N |
| XLogP | 1.55 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |