C19H19N3O3 — CID 95543421
ethyl 3-[6-amino-5-cyano-4-[(3R)-oxolan-3-yl]-2-pyridinyl]benzoate (PubChem CID 95543421) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is ethyl 3-[6-amino-5-cyano-4-[(3R)-oxolan-3-yl]-2-pyridinyl]benzoate.
| Compound Name | ethyl 3-[6-amino-5-cyano-4-[(3R)-oxolan-3-yl]-2-pyridinyl]benzoate |
|---|---|
| PubChem CID | 95543421 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | ethyl 3-[6-amino-5-cyano-4-[(3R)-oxolan-3-yl]-2-pyridinyl]benzoate |
| SMILES | CCOC(=O)c1cccc(-c2cc([C@H]3CCOC3)c(C#N)c(N)n2)c1 |
| InChI | InChI=1S/C19H19N3O3/c1-2-25-19(23)13-5-3-4-12(8-13)17-9-15(14-6-7-24-11-14)16(10-20)18(21)22-17/h3-5,8-9,14H,2,6-7,11H2,1H3,(H2,21,22)/t14-/m0/s1 |
| InChIKey | ALMGARKQUHWXJZ-AWEZNQCLSA-N |
| XLogP | 2.88 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |