C16H18ClN3O2 — CID 95551475
(2S)-4-(6-chloropyridazin-3-yl)-2-[(3-methoxyphenyl)methyl]morpholine (PubChem CID 95551475) has the molecular formula C16H18ClN3O2 and a molecular weight of 319.79 g/mol. Its IUPAC name is (2S)-4-(6-chloropyridazin-3-yl)-2-[(3-methoxyphenyl)methyl]morpholine.
| Compound Name | (2S)-4-(6-chloropyridazin-3-yl)-2-[(3-methoxyphenyl)methyl]morpholine |
|---|---|
| PubChem CID | 95551475 |
| Molecular Formula | C16H18ClN3O2 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | (2S)-4-(6-chloropyridazin-3-yl)-2-[(3-methoxyphenyl)methyl]morpholine |
| SMILES | COc1cccc(C[C@H]2CN(c3ccc(Cl)nn3)CCO2)c1 |
| InChI | InChI=1S/C16H18ClN3O2/c1-21-13-4-2-3-12(9-13)10-14-11-20(7-8-22-14)16-6-5-15(17)18-19-16/h2-6,9,14H,7-8,10-11H2,1H3/t14-/m0/s1 |
| InChIKey | AMJVNJKPMJCLBD-AWEZNQCLSA-N |
| XLogP | 2.59 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |