C15H16F3N3O3 — CID 95556081
methyl 1-methyl-2-[(2S)-2-(trifluoromethyl)morpholin-4-yl]benzimidazole-5-carboxylate (PubChem CID 95556081) has the molecular formula C15H16F3N3O3 and a molecular weight of 343.31 g/mol. Its IUPAC name is methyl 1-methyl-2-[(2S)-2-(trifluoromethyl)morpholin-4-yl]benzimidazole-5-carboxylate.
| Compound Name | methyl 1-methyl-2-[(2S)-2-(trifluoromethyl)morpholin-4-yl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 95556081 |
| Molecular Formula | C15H16F3N3O3 |
| Molecular Weight | 343.31 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | methyl 1-methyl-2-[(2S)-2-(trifluoromethyl)morpholin-4-yl]benzimidazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)nc(N1CCO[C@H](C(F)(F)F)C1)n2C |
| InChI | InChI=1S/C15H16F3N3O3/c1-20-11-4-3-9(13(22)23-2)7-10(11)19-14(20)21-5-6-24-12(8-21)15(16,17)18/h3-4,7,12H,5-6,8H2,1-2H3/t12-/m0/s1 |
| InChIKey | BODRGZSTZYKPDO-LBPRGKRZSA-N |
| XLogP | 2.13 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |