C16H11Cl3N4 — CID 95559270
3-[[2,2,2-trichloro-1-(3-cyanoanilino)ethyl]amino]benzonitrile (PubChem CID 95559270) has the molecular formula C16H11Cl3N4 and a molecular weight of 365.65 g/mol. Its IUPAC name is 3-[[2,2,2-trichloro-1-(3-cyanoanilino)ethyl]amino]benzonitrile.
| Compound Name | 3-[[2,2,2-trichloro-1-(3-cyanoanilino)ethyl]amino]benzonitrile |
|---|---|
| PubChem CID | 95559270 |
| Molecular Formula | C16H11Cl3N4 |
| Molecular Weight | 365.65 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | 3-[[2,2,2-trichloro-1-(3-cyanoanilino)ethyl]amino]benzonitrile |
| SMILES | N#Cc1cccc(NC(Nc2cccc(C#N)c2)C(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C16H11Cl3N4/c17-16(18,19)15(22-13-5-1-3-11(7-13)9-20)23-14-6-2-4-12(8-14)10-21/h1-8,15,22-23H |
| InChIKey | FRDPCPVAHOIRQO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.65 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|