C20H30N4O3 — CID 95560901
morpholin-4-yl-[(3R)-1-[1-(1H-pyrrole-2-carbonyl)piperidin-4-yl]piperidin-3-yl]methanone (PubChem CID 95560901) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is morpholin-4-yl-[(3R)-1-[1-(1H-pyrrole-2-carbonyl)piperidin-4-yl]piperidin-3-yl]methanone.
| Compound Name | morpholin-4-yl-[(3R)-1-[1-(1H-pyrrole-2-carbonyl)piperidin-4-yl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 95560901 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | morpholin-4-yl-[(3R)-1-[1-(1H-pyrrole-2-carbonyl)piperidin-4-yl]piperidin-3-yl]methanone |
| SMILES | O=C(c1ccc[nH]1)N1CCC(N2CCC[C@@H](C(=O)N3CCOCC3)C2)CC1 |
| InChI | InChI=1S/C20H30N4O3/c25-19(23-11-13-27-14-12-23)16-3-2-8-24(15-16)17-5-9-22(10-6-17)20(26)18-4-1-7-21-18/h1,4,7,16-17,21H,2-3,5-6,8-15H2/t16-/m1/s1 |
| InChIKey | CQOJHOPQRVVOGJ-MRXNPFEDSA-N |
| XLogP | 1.19 |
| TPSA | 68.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |