About 3-[(2S)-2,3-dihydroxypropyl]-1H-benzimidazol-2-one
3-[(2S)-2,3-dihydroxypropyl]-1H-benzimidazol-2-one (PubChem CID 95561994) has the molecular formula C10H12N2O3
and a molecular weight of 208.22 g/mol. Its IUPAC name is 3-[(2S)-2,3-dihydroxypropyl]-1H-benzimidazol-2-one.
Molecular Properties
| Compound Name | 3-[(2S)-2,3-dihydroxypropyl]-1H-benzimidazol-2-one |
| PubChem CID | 95561994 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 3-[(2S)-2,3-dihydroxypropyl]-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2ccccc2n1C[C@H](O)CO |
| InChI | InChI=1S/C10H12N2O3/c13-6-7(14)5-12-9-4-2-1-3-8(9)11-10(12)15/h1-4,7,13-14H,5-6H2,(H,11,15)/t7-/m0/s1 |
| InChIKey | SRPPCGGWWSCKMP-ZETCQYMHSA-N |
| XLogP | -0.32 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(2S)-2,3-dihydroxypropyl]-1H-benzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S)-2,3-dihydroxypropyl]-1H-benzimidazol-2-one?
The IUPAC name of 3-[(2S)-2,3-dihydroxypropyl]-1H-benzimidazol-2-one (CID 95561994) is 3-[(2S)-2,3-dihydroxypropyl]-1H-benzimidazol-2-one.
What is the SMILES notation for 3-[(2S)-2,3-dihydroxypropyl]-1H-benzimidazol-2-one?
The canonical SMILES for 3-[(2S)-2,3-dihydroxypropyl]-1H-benzimidazol-2-one is O=c1[nH]c2ccccc2n1C[C@H](O)CO.
What is the InChIKey of 3-[(2S)-2,3-dihydroxypropyl]-1H-benzimidazol-2-one?
The InChIKey is SRPPCGGWWSCKMP-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H12N2O3/c13-6-7(14)5-12-9-4-2-1-3-8(9)11-10(12)15/h1-4,7,13-14H,5-6H2,(H,11,15)/t7-/m0/s1.
What are the key properties of 3-[(2S)-2,3-dihydroxypropyl]-1H-benzimidazol-2-one?
3-[(2S)-2,3-dihydroxypropyl]-1H-benzimidazol-2-one has a molecular weight of 208.22 g/mol, XLogP of -0.32, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S)-2,3-dihydroxypropyl]-1H-benzimidazol-2-one is sourced from PubChem (CID 95561994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).