C10H13ClO3S — CID 95563995
(3,4,5-trimethylphenyl) chloromethanesulfonate (PubChem CID 95563995) has the molecular formula C10H13ClO3S and a molecular weight of 248.73 g/mol. Its IUPAC name is (3,4,5-trimethylphenyl) chloromethanesulfonate.
| Compound Name | (3,4,5-trimethylphenyl) chloromethanesulfonate |
|---|---|
| PubChem CID | 95563995 |
| Molecular Formula | C10H13ClO3S |
| Molecular Weight | 248.73 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | (3,4,5-trimethylphenyl) chloromethanesulfonate |
| SMILES | Cc1cc(OS(=O)(=O)CCl)cc(C)c1C |
| InChI | InChI=1S/C10H13ClO3S/c1-7-4-10(5-8(2)9(7)3)14-15(12,13)6-11/h4-5H,6H2,1-3H3 |
| InChIKey | RWKCSXCTWSVZCV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.73 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|