C13H16O2 — CID 95565401
methyl (1S,5R,8S)-tricyclo[6.3.0.01,5]undeca-3,10-diene-4-carboxylate (PubChem CID 95565401) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is methyl (1S,5R,8S)-tricyclo[6.3.0.01,5]undeca-3,10-diene-4-carboxylate.
| Compound Name | methyl (1S,5R,8S)-tricyclo[6.3.0.01,5]undeca-3,10-diene-4-carboxylate |
|---|---|
| PubChem CID | 95565401 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | methyl (1S,5R,8S)-tricyclo[6.3.0.01,5]undeca-3,10-diene-4-carboxylate |
| SMILES | COC(=O)C1=CC[C@@]23C=CC[C@@H]2CC[C@@H]13 |
| InChI | InChI=1S/C13H16O2/c1-15-12(14)10-6-8-13-7-2-3-9(13)4-5-11(10)13/h2,6-7,9,11H,3-5,8H2,1H3/t9-,11+,13+/m1/s1 |
| InChIKey | QYPIELPMZNOMBJ-CDMKHQONSA-N |
| XLogP | 2.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|