C17H23NO4 — CID 95566665
tert-butyl (4S)-4-(3-methoxyphenyl)-3-oxopiperidine-1-carboxylate (PubChem CID 95566665) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is tert-butyl (4S)-4-(3-methoxyphenyl)-3-oxopiperidine-1-carboxylate.
| Compound Name | tert-butyl (4S)-4-(3-methoxyphenyl)-3-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 95566665 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | tert-butyl (4S)-4-(3-methoxyphenyl)-3-oxopiperidine-1-carboxylate |
| SMILES | COc1cccc([C@@H]2CCN(C(=O)OC(C)(C)C)CC2=O)c1 |
| InChI | InChI=1S/C17H23NO4/c1-17(2,3)22-16(20)18-9-8-14(15(19)11-18)12-6-5-7-13(10-12)21-4/h5-7,10,14H,8-9,11H2,1-4H3/t14-/m0/s1 |
| InChIKey | OAWXZZLRKNJQJS-AWEZNQCLSA-N |
| XLogP | 2.99 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |