C18H23N3O2S — CID 95567423
5,5-dicyclopropyl-3-[[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]methyl]imidazolidine-2,4-dione (PubChem CID 95567423) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is 5,5-dicyclopropyl-3-[[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-dicyclopropyl-3-[[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95567423 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 5,5-dicyclopropyl-3-[[(2R)-2-thiophen-3-ylpyrrolidin-1-yl]methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(C2CC2)(C2CC2)C(=O)N1CN1CCC[C@@H]1c1ccsc1 |
| InChI | InChI=1S/C18H23N3O2S/c22-16-18(13-3-4-13,14-5-6-14)19-17(23)21(16)11-20-8-1-2-15(20)12-7-9-24-10-12/h7,9-10,13-15H,1-6,8,11H2,(H,19,23)/t15-/m1/s1 |
| InChIKey | ULGNXPMQMJVMDO-OAHLLOKOSA-N |
| XLogP | 2.95 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|