C18H17FN2O3 — CID 95568995
N-[(3R)-6,7-dimethyl-2,3-dihydro-1-benzofuran-3-yl]-N'-(3-fluorophenyl)oxamide (PubChem CID 95568995) has the molecular formula C18H17FN2O3 and a molecular weight of 328.34 g/mol. Its IUPAC name is N-[(3R)-6,7-dimethyl-2,3-dihydro-1-benzofuran-3-yl]-N'-(3-fluorophenyl)oxamide.
| Compound Name | N-[(3R)-6,7-dimethyl-2,3-dihydro-1-benzofuran-3-yl]-N'-(3-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 95568995 |
| Molecular Formula | C18H17FN2O3 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | N-[(3R)-6,7-dimethyl-2,3-dihydro-1-benzofuran-3-yl]-N'-(3-fluorophenyl)oxamide |
| SMILES | Cc1ccc2c(c1C)OC[C@@H]2NC(=O)C(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C18H17FN2O3/c1-10-6-7-14-15(9-24-16(14)11(10)2)21-18(23)17(22)20-13-5-3-4-12(19)8-13/h3-8,15H,9H2,1-2H3,(H,20,22)(H,21,23)/t15-/m0/s1 |
| InChIKey | GOVIKRSVLLYHBT-HNNXBMFYSA-N |
| XLogP | 2.63 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|