C16H15BrClFN2O3S — CID 95579014
5-bromo-2-chloro-N-[(R)-(4-fluorophenyl)-[(2S)-oxolan-2-yl]methyl]pyridine-3-sulfonamide (PubChem CID 95579014) has the molecular formula C16H15BrClFN2O3S and a molecular weight of 449.73 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[(R)-(4-fluorophenyl)-[(2S)-oxolan-2-yl]methyl]pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-chloro-N-[(R)-(4-fluorophenyl)-[(2S)-oxolan-2-yl]methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 95579014 |
| Molecular Formula | C16H15BrClFN2O3S |
| Molecular Weight | 449.73 g/mol |
| Exact Mass | 447.97 |
| IUPAC Name | 5-bromo-2-chloro-N-[(R)-(4-fluorophenyl)-[(2S)-oxolan-2-yl]methyl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(N[C@H](c1ccc(F)cc1)[C@@H]1CCCO1)c1cc(Br)cnc1Cl |
| InChI | InChI=1S/C16H15BrClFN2O3S/c17-11-8-14(16(18)20-9-11)25(22,23)21-15(13-2-1-7-24-13)10-3-5-12(19)6-4-10/h3-6,8-9,13,15,21H,1-2,7H2/t13-,15+/m0/s1 |
| InChIKey | KGCPYSYJSKYVSR-DZGCQCFKSA-N |
| XLogP | 3.84 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.73 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|