C20H22BrFN2O2 — CID 60547734
1-[1-(3-bromophenyl)ethyl]-3-[(4-fluorophenyl)-(oxolan-2-yl)methyl]urea (PubChem CID 60547734) has the molecular formula C20H22BrFN2O2 and a molecular weight of 421.31 g/mol. Its IUPAC name is 1-[1-(3-bromophenyl)ethyl]-3-[(4-fluorophenyl)-(oxolan-2-yl)methyl]urea.
| Compound Name | 1-[1-(3-bromophenyl)ethyl]-3-[(4-fluorophenyl)-(oxolan-2-yl)methyl]urea |
|---|---|
| PubChem CID | 60547734 |
| Molecular Formula | C20H22BrFN2O2 |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 420.08 |
| IUPAC Name | 1-[1-(3-bromophenyl)ethyl]-3-[(4-fluorophenyl)-(oxolan-2-yl)methyl]urea |
| SMILES | CC(NC(=O)NC(c1ccc(F)cc1)C1CCCO1)c1cccc(Br)c1 |
| InChI | InChI=1S/C20H22BrFN2O2/c1-13(15-4-2-5-16(21)12-15)23-20(25)24-19(18-6-3-11-26-18)14-7-9-17(22)10-8-14/h2,4-5,7-10,12-13,18-19H,3,6,11H2,1H3,(H2,23,24,25) |
| InChIKey | WGIBYJZTFMEWER-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |