C17H22O3 — CID 95585511
[(1S,6R)-6-methylcyclohex-3-en-1-yl]methyl 2-(3-methoxyphenyl)acetate (PubChem CID 95585511) has the molecular formula C17H22O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is [(1S,6R)-6-methylcyclohex-3-en-1-yl]methyl 2-(3-methoxyphenyl)acetate.
| Compound Name | [(1S,6R)-6-methylcyclohex-3-en-1-yl]methyl 2-(3-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 95585511 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | [(1S,6R)-6-methylcyclohex-3-en-1-yl]methyl 2-(3-methoxyphenyl)acetate |
| SMILES | COc1cccc(CC(=O)OC[C@H]2CC=CC[C@H]2C)c1 |
| InChI | InChI=1S/C17H22O3/c1-13-6-3-4-8-15(13)12-20-17(18)11-14-7-5-9-16(10-14)19-2/h3-5,7,9-10,13,15H,6,8,11-12H2,1-2H3/t13-,15-/m1/s1 |
| InChIKey | ZHRAGALHFDDRFS-UKRRQHHQSA-N |
| XLogP | 3.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|