C17H21N3O2S — CID 95591134
N-[2-[[(2R)-1-(N-methylanilino)propan-2-yl]amino]-2-oxoethyl]thiophene-3-carboxamide (PubChem CID 95591134) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is N-[2-[[(2R)-1-(N-methylanilino)propan-2-yl]amino]-2-oxoethyl]thiophene-3-carboxamide.
| Compound Name | N-[2-[[(2R)-1-(N-methylanilino)propan-2-yl]amino]-2-oxoethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 95591134 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | N-[2-[[(2R)-1-(N-methylanilino)propan-2-yl]amino]-2-oxoethyl]thiophene-3-carboxamide |
| SMILES | C[C@H](CN(C)c1ccccc1)NC(=O)CNC(=O)c1ccsc1 |
| InChI | InChI=1S/C17H21N3O2S/c1-13(11-20(2)15-6-4-3-5-7-15)19-16(21)10-18-17(22)14-8-9-23-12-14/h3-9,12-13H,10-11H2,1-2H3,(H,18,22)(H,19,21)/t13-/m1/s1 |
| InChIKey | MASFQGGEVGDFLM-CYBMUJFWSA-N |
| XLogP | 2.12 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |