C16H23N3OS2 — CID 95592122
(2R)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]-2-(1,3,5-trimethylpyrazol-4-yl)propanamide (PubChem CID 95592122) has the molecular formula C16H23N3OS2 and a molecular weight of 337.51 g/mol. Its IUPAC name is (2R)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]-2-(1,3,5-trimethylpyrazol-4-yl)propanamide.
| Compound Name | (2R)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]-2-(1,3,5-trimethylpyrazol-4-yl)propanamide |
|---|---|
| PubChem CID | 95592122 |
| Molecular Formula | C16H23N3OS2 |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | (2R)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]-2-(1,3,5-trimethylpyrazol-4-yl)propanamide |
| SMILES | Cc1nn(C)c(C)c1[C@@H](C)C(=O)NCCSCc1cccs1 |
| InChI | InChI=1S/C16H23N3OS2/c1-11(15-12(2)18-19(4)13(15)3)16(20)17-7-9-21-10-14-6-5-8-22-14/h5-6,8,11H,7,9-10H2,1-4H3,(H,17,20)/t11-/m1/s1 |
| InChIKey | PZELGEGDPGUSOC-LLVKDONJSA-N |
| XLogP | 3.25 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|