C17H26N6O2 — CID 95599997
N-[(3R)-2-oxoazepan-3-yl]-2-[[(3S)-1-pyridazin-3-ylpiperidin-3-yl]amino]acetamide (PubChem CID 95599997) has the molecular formula C17H26N6O2 and a molecular weight of 346.44 g/mol. Its IUPAC name is N-[(3R)-2-oxoazepan-3-yl]-2-[[(3S)-1-pyridazin-3-ylpiperidin-3-yl]amino]acetamide.
| Compound Name | N-[(3R)-2-oxoazepan-3-yl]-2-[[(3S)-1-pyridazin-3-ylpiperidin-3-yl]amino]acetamide |
|---|---|
| PubChem CID | 95599997 |
| Molecular Formula | C17H26N6O2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | N-[(3R)-2-oxoazepan-3-yl]-2-[[(3S)-1-pyridazin-3-ylpiperidin-3-yl]amino]acetamide |
| SMILES | O=C(CN[C@H]1CCCN(c2cccnn2)C1)N[C@@H]1CCCCNC1=O |
| InChI | InChI=1S/C17H26N6O2/c24-16(21-14-6-1-2-8-18-17(14)25)11-19-13-5-4-10-23(12-13)15-7-3-9-20-22-15/h3,7,9,13-14,19H,1-2,4-6,8,10-12H2,(H,18,25)(H,21,24)/t13-,14+/m0/s1 |
| InChIKey | LEVPPMYARCWOGT-UONOGXRCSA-N |
| XLogP | -0.18 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |