C16H21N5OS — CID 95349268
2-[[(3R)-1-pyridazin-3-ylpiperidin-3-yl]amino]-N-(thiophen-2-ylmethyl)acetamide (PubChem CID 95349268) has the molecular formula C16H21N5OS and a molecular weight of 331.45 g/mol. Its IUPAC name is 2-[[(3R)-1-pyridazin-3-ylpiperidin-3-yl]amino]-N-(thiophen-2-ylmethyl)acetamide.
| Compound Name | 2-[[(3R)-1-pyridazin-3-ylpiperidin-3-yl]amino]-N-(thiophen-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 95349268 |
| Molecular Formula | C16H21N5OS |
| Molecular Weight | 331.45 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 2-[[(3R)-1-pyridazin-3-ylpiperidin-3-yl]amino]-N-(thiophen-2-ylmethyl)acetamide |
| SMILES | O=C(CN[C@@H]1CCCN(c2cccnn2)C1)NCc1cccs1 |
| InChI | InChI=1S/C16H21N5OS/c22-16(18-10-14-5-3-9-23-14)11-17-13-4-2-8-21(12-13)15-6-1-7-19-20-15/h1,3,5-7,9,13,17H,2,4,8,10-12H2,(H,18,22)/t13-/m1/s1 |
| InChIKey | JIXZBFYEZPRJPZ-CYBMUJFWSA-N |
| XLogP | 1.41 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.45 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |