C16H27N3O2S — CID 95606770
(2S)-2-[[1-(2-hydroxyethyl)piperidin-4-yl]methylamino]-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 95606770) has the molecular formula C16H27N3O2S and a molecular weight of 325.48 g/mol. Its IUPAC name is (2S)-2-[[1-(2-hydroxyethyl)piperidin-4-yl]methylamino]-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | (2S)-2-[[1-(2-hydroxyethyl)piperidin-4-yl]methylamino]-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 95606770 |
| Molecular Formula | C16H27N3O2S |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | (2S)-2-[[1-(2-hydroxyethyl)piperidin-4-yl]methylamino]-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | C[C@H](NCC1CCN(CCO)CC1)C(=O)NCc1cccs1 |
| InChI | InChI=1S/C16H27N3O2S/c1-13(16(21)18-12-15-3-2-10-22-15)17-11-14-4-6-19(7-5-14)8-9-20/h2-3,10,13-14,17,20H,4-9,11-12H2,1H3,(H,18,21)/t13-/m0/s1 |
| InChIKey | ZZRMWILXDHOYEP-ZDUSSCGKSA-N |
| XLogP | 1.05 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |