C17H23N5O2 — CID 95613153
[4-[(2S)-2-hydroxybutyl]piperazin-1-yl]-(2-imidazol-1-yl-4-pyridinyl)methanone (PubChem CID 95613153) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is [4-[(2S)-2-hydroxybutyl]piperazin-1-yl]-(2-imidazol-1-yl-4-pyridinyl)methanone.
| Compound Name | [4-[(2S)-2-hydroxybutyl]piperazin-1-yl]-(2-imidazol-1-yl-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 95613153 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | [4-[(2S)-2-hydroxybutyl]piperazin-1-yl]-(2-imidazol-1-yl-4-pyridinyl)methanone |
| SMILES | CC[C@H](O)CN1CCN(C(=O)c2ccnc(-n3ccnc3)c2)CC1 |
| InChI | InChI=1S/C17H23N5O2/c1-2-15(23)12-20-7-9-21(10-8-20)17(24)14-3-4-19-16(11-14)22-6-5-18-13-22/h3-6,11,13,15,23H,2,7-10,12H2,1H3/t15-/m0/s1 |
| InChIKey | XIZMGLDEAKDVEO-HNNXBMFYSA-N |
| XLogP | 0.80 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |