C12H14N4O4S2 — CID 95621129
(4R)-N-(5-methyl-1,3-thiazol-2-yl)-3-[(1R,2S)-2-nitrocyclopropanecarbonyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 95621129) has the molecular formula C12H14N4O4S2 and a molecular weight of 342.40 g/mol. Its IUPAC name is (4R)-N-(5-methyl-1,3-thiazol-2-yl)-3-[(1R,2S)-2-nitrocyclopropanecarbonyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-N-(5-methyl-1,3-thiazol-2-yl)-3-[(1R,2S)-2-nitrocyclopropanecarbonyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 95621129 |
| Molecular Formula | C12H14N4O4S2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | (4R)-N-(5-methyl-1,3-thiazol-2-yl)-3-[(1R,2S)-2-nitrocyclopropanecarbonyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | Cc1cnc(NC(=O)[C@@H]2CSCN2C(=O)[C@@H]2C[C@@H]2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C12H14N4O4S2/c1-6-3-13-12(22-6)14-10(17)9-4-21-5-15(9)11(18)7-2-8(7)16(19)20/h3,7-9H,2,4-5H2,1H3,(H,13,14,17)/t7-,8+,9+/m1/s1 |
| InChIKey | VVSQMNRJNHSWRR-VGMNWLOBSA-N |
| XLogP | 0.96 |
| TPSA | 105.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|