C14H18FNO2S — CID 95621354
(Z)-3-(3-fluorophenyl)-N-[3-[(R)-methylsulfinyl]propyl]but-2-enamide (PubChem CID 95621354) has the molecular formula C14H18FNO2S and a molecular weight of 283.37 g/mol. Its IUPAC name is (Z)-3-(3-fluorophenyl)-N-[3-[(R)-methylsulfinyl]propyl]but-2-enamide.
| Compound Name | (Z)-3-(3-fluorophenyl)-N-[3-[(R)-methylsulfinyl]propyl]but-2-enamide |
|---|---|
| PubChem CID | 95621354 |
| Molecular Formula | C14H18FNO2S |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (Z)-3-(3-fluorophenyl)-N-[3-[(R)-methylsulfinyl]propyl]but-2-enamide |
| SMILES | C/C(=C/C(=O)NCCC[S@@](C)=O)c1cccc(F)c1 |
| InChI | InChI=1S/C14H18FNO2S/c1-11(12-5-3-6-13(15)10-12)9-14(17)16-7-4-8-19(2)18/h3,5-6,9-10H,4,7-8H2,1-2H3,(H,16,17)/b11-9-/t19-/m1/s1 |
| InChIKey | NOQIGQCLJWAXPD-ZMOVQZPESA-N |
| XLogP | 2.11 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|