C19H26N4O2 — CID 95621579
(2R)-2-[4-[2-[(3S)-3-hydroxypiperidin-1-yl]acetyl]piperazin-1-yl]-2-phenylacetonitrile (PubChem CID 95621579) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is (2R)-2-[4-[2-[(3S)-3-hydroxypiperidin-1-yl]acetyl]piperazin-1-yl]-2-phenylacetonitrile.
| Compound Name | (2R)-2-[4-[2-[(3S)-3-hydroxypiperidin-1-yl]acetyl]piperazin-1-yl]-2-phenylacetonitrile |
|---|---|
| PubChem CID | 95621579 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | (2R)-2-[4-[2-[(3S)-3-hydroxypiperidin-1-yl]acetyl]piperazin-1-yl]-2-phenylacetonitrile |
| SMILES | N#C[C@@H](c1ccccc1)N1CCN(C(=O)CN2CCC[C@H](O)C2)CC1 |
| InChI | InChI=1S/C19H26N4O2/c20-13-18(16-5-2-1-3-6-16)22-9-11-23(12-10-22)19(25)15-21-8-4-7-17(24)14-21/h1-3,5-6,17-18,24H,4,7-12,14-15H2/t17-,18-/m0/s1 |
| InChIKey | UPZRRJULQGTIGN-ROUUACIJSA-N |
| XLogP | 0.85 |
| TPSA | 70.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |