C15H21N3O2S2 — CID 95623230
(4R)-N,N-diethyl-3-[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 95623230) has the molecular formula C15H21N3O2S2 and a molecular weight of 339.49 g/mol. Its IUPAC name is (4R)-N,N-diethyl-3-[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-N,N-diethyl-3-[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 95623230 |
| Molecular Formula | C15H21N3O2S2 |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | (4R)-N,N-diethyl-3-[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1CSCN1C(=O)/C=C/c1cnc(C)s1 |
| InChI | InChI=1S/C15H21N3O2S2/c1-4-17(5-2)15(20)13-9-21-10-18(13)14(19)7-6-12-8-16-11(3)22-12/h6-8,13H,4-5,9-10H2,1-3H3/b7-6+/t13-/m0/s1 |
| InChIKey | RUARMZQIJILIMG-YBJDMEARSA-N |
| XLogP | 2.23 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|