C11H15NS — CID 143346068
5-[(1Z,3Z)-3-ethylpenta-1,3-dienyl]-2-methyl-1,3-thiazole (PubChem CID 143346068) has the molecular formula C11H15NS and a molecular weight of 193.31 g/mol. Its IUPAC name is 5-[(1Z,3Z)-3-ethylpenta-1,3-dienyl]-2-methyl-1,3-thiazole.
| Compound Name | 5-[(1Z,3Z)-3-ethylpenta-1,3-dienyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 143346068 |
| Molecular Formula | C11H15NS |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 5-[(1Z,3Z)-3-ethylpenta-1,3-dienyl]-2-methyl-1,3-thiazole |
| SMILES | C/C=C(\C=C/c1cnc(C)s1)CC |
| InChI | InChI=1S/C11H15NS/c1-4-10(5-2)6-7-11-8-12-9(3)13-11/h4,6-8H,5H2,1-3H3/b7-6-,10-4- |
| InChIKey | NGACTYKLPDSYRF-JICONFDSSA-N |
| XLogP | 3.82 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|