C18H20N2O3S — CID 75407258
ethyl 2-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]-3-phenylpropanoate (PubChem CID 75407258) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is ethyl 2-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]-3-phenylpropanoate.
| Compound Name | ethyl 2-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 75407258 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | ethyl 2-[[(E)-3-(2-methyl-1,3-thiazol-5-yl)prop-2-enoyl]amino]-3-phenylpropanoate |
| SMILES | CCOC(=O)C(Cc1ccccc1)NC(=O)/C=C/c1cnc(C)s1 |
| InChI | InChI=1S/C18H20N2O3S/c1-3-23-18(22)16(11-14-7-5-4-6-8-14)20-17(21)10-9-15-12-19-13(2)24-15/h4-10,12,16H,3,11H2,1-2H3,(H,20,21)/b10-9+ |
| InChIKey | NKPOLSVNGHGIIN-MDZDMXLPSA-N |
| XLogP | 2.76 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|