C17H24N2O5 — CID 95624318
methyl 4-[4-[[(3S)-oxan-3-yl]carbamoylamino]phenoxy]butanoate (PubChem CID 95624318) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is methyl 4-[4-[[(3S)-oxan-3-yl]carbamoylamino]phenoxy]butanoate.
| Compound Name | methyl 4-[4-[[(3S)-oxan-3-yl]carbamoylamino]phenoxy]butanoate |
|---|---|
| PubChem CID | 95624318 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | methyl 4-[4-[[(3S)-oxan-3-yl]carbamoylamino]phenoxy]butanoate |
| SMILES | COC(=O)CCCOc1ccc(NC(=O)N[C@H]2CCCOC2)cc1 |
| InChI | InChI=1S/C17H24N2O5/c1-22-16(20)5-3-11-24-15-8-6-13(7-9-15)18-17(21)19-14-4-2-10-23-12-14/h6-9,14H,2-5,10-12H2,1H3,(H2,18,19,21)/t14-/m0/s1 |
| InChIKey | XSHKTBFYXPQLMD-AWEZNQCLSA-N |
| XLogP | 2.32 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|