C15H20N2O4 — CID 49288381
methyl 3-[4-(cyclopropylmethylcarbamoylamino)phenoxy]propanoate (PubChem CID 49288381) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is methyl 3-[4-(cyclopropylmethylcarbamoylamino)phenoxy]propanoate.
| Compound Name | methyl 3-[4-(cyclopropylmethylcarbamoylamino)phenoxy]propanoate |
|---|---|
| PubChem CID | 49288381 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | methyl 3-[4-(cyclopropylmethylcarbamoylamino)phenoxy]propanoate |
| SMILES | COC(=O)CCOc1ccc(NC(=O)NCC2CC2)cc1 |
| InChI | InChI=1S/C15H20N2O4/c1-20-14(18)8-9-21-13-6-4-12(5-7-13)17-15(19)16-10-11-2-3-11/h4-7,11H,2-3,8-10H2,1H3,(H2,16,17,19) |
| InChIKey | RUAKDQOIOWXIOC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |