C10H20N2O2S — CID 95626009
N-[2-[[(1S)-cyclohex-2-en-1-yl]-methylamino]ethyl]methanesulfonamide (PubChem CID 95626009) has the molecular formula C10H20N2O2S and a molecular weight of 232.35 g/mol. Its IUPAC name is N-[2-[[(1S)-cyclohex-2-en-1-yl]-methylamino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[[(1S)-cyclohex-2-en-1-yl]-methylamino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 95626009 |
| Molecular Formula | C10H20N2O2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | N-[2-[[(1S)-cyclohex-2-en-1-yl]-methylamino]ethyl]methanesulfonamide |
| SMILES | CN(CCNS(C)(=O)=O)[C@@H]1C=CCCC1 |
| InChI | InChI=1S/C10H20N2O2S/c1-12(9-8-11-15(2,13)14)10-6-4-3-5-7-10/h4,6,10-11H,3,5,7-9H2,1-2H3/t10-/m1/s1 |
| InChIKey | OXBSRAGECROEAZ-SNVBAGLBSA-N |
| XLogP | 0.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|