C17H21N5O2 — CID 95629996
N-[(S)-cyclopropyl-[2-[[(2R)-oxolan-2-yl]methyl]tetrazol-5-yl]methyl]benzamide (PubChem CID 95629996) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is N-[(S)-cyclopropyl-[2-[[(2R)-oxolan-2-yl]methyl]tetrazol-5-yl]methyl]benzamide.
| Compound Name | N-[(S)-cyclopropyl-[2-[[(2R)-oxolan-2-yl]methyl]tetrazol-5-yl]methyl]benzamide |
|---|---|
| PubChem CID | 95629996 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | N-[(S)-cyclopropyl-[2-[[(2R)-oxolan-2-yl]methyl]tetrazol-5-yl]methyl]benzamide |
| SMILES | O=C(N[C@H](c1nnn(C[C@H]2CCCO2)n1)C1CC1)c1ccccc1 |
| InChI | InChI=1S/C17H21N5O2/c23-17(13-5-2-1-3-6-13)18-15(12-8-9-12)16-19-21-22(20-16)11-14-7-4-10-24-14/h1-3,5-6,12,14-15H,4,7-11H2,(H,18,23)/t14-,15+/m1/s1 |
| InChIKey | JAMVURJUVMCFEK-CABCVRRESA-N |
| XLogP | 1.73 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |