C12H12Cl2N2O4 — CID 95630200
trans-(1S,2S)-N-[(2R)-2-(3,5-dichlorophenyl)-2-hydroxyethyl]-2-nitrocyclopropane-1-carboxamide (PubChem CID 95630200) has the molecular formula C12H12Cl2N2O4 and a molecular weight of 319.14 g/mol. Its IUPAC name is trans-(1S,2S)-N-[(2R)-2-(3,5-dichlorophenyl)-2-hydroxyethyl]-2-nitrocyclopropane-1-carboxamide.
| Compound Name | trans-(1S,2S)-N-[(2R)-2-(3,5-dichlorophenyl)-2-hydroxyethyl]-2-nitrocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 95630200 |
| Molecular Formula | C12H12Cl2N2O4 |
| Molecular Weight | 319.14 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | trans-(1S,2S)-N-[(2R)-2-(3,5-dichlorophenyl)-2-hydroxyethyl]-2-nitrocyclopropane-1-carboxamide |
| SMILES | O=C(NC[C@H](O)c1cc(Cl)cc(Cl)c1)[C@H]1C[C@@H]1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12Cl2N2O4/c13-7-1-6(2-8(14)3-7)11(17)5-15-12(18)9-4-10(9)16(19)20/h1-3,9-11,17H,4-5H2,(H,15,18)/t9-,10-,11-/m0/s1 |
| InChIKey | XCMJLJXOHPFWMK-DCAQKATOSA-N |
| XLogP | 1.81 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.14 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|