C19H29N3O3 — CID 95635747
[(2S)-1-oxo-1-(propylamino)propan-2-yl] 2-(4-benzylpiperazin-1-yl)acetate (PubChem CID 95635747) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(propylamino)propan-2-yl] 2-(4-benzylpiperazin-1-yl)acetate.
| Compound Name | [(2S)-1-oxo-1-(propylamino)propan-2-yl] 2-(4-benzylpiperazin-1-yl)acetate |
|---|---|
| PubChem CID | 95635747 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | [(2S)-1-oxo-1-(propylamino)propan-2-yl] 2-(4-benzylpiperazin-1-yl)acetate |
| SMILES | CCCNC(=O)[C@H](C)OC(=O)CN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C19H29N3O3/c1-3-9-20-19(24)16(2)25-18(23)15-22-12-10-21(11-13-22)14-17-7-5-4-6-8-17/h4-8,16H,3,9-15H2,1-2H3,(H,20,24)/t16-/m0/s1 |
| InChIKey | VULYWVYJDFVPRR-INIZCTEOSA-N |
| XLogP | 1.26 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |