C15H27N3O4 — CID 95636021
tert-butyl 4-[2-[[(2S)-butan-2-yl]amino]-2-oxoethyl]-3-oxopiperazine-1-carboxylate (PubChem CID 95636021) has the molecular formula C15H27N3O4 and a molecular weight of 313.40 g/mol. Its IUPAC name is tert-butyl 4-[2-[[(2S)-butan-2-yl]amino]-2-oxoethyl]-3-oxopiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[(2S)-butan-2-yl]amino]-2-oxoethyl]-3-oxopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 95636021 |
| Molecular Formula | C15H27N3O4 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | tert-butyl 4-[2-[[(2S)-butan-2-yl]amino]-2-oxoethyl]-3-oxopiperazine-1-carboxylate |
| SMILES | CC[C@H](C)NC(=O)CN1CCN(C(=O)OC(C)(C)C)CC1=O |
| InChI | InChI=1S/C15H27N3O4/c1-6-11(2)16-12(19)9-17-7-8-18(10-13(17)20)14(21)22-15(3,4)5/h11H,6-10H2,1-5H3,(H,16,19)/t11-/m0/s1 |
| InChIKey | QQXVCQSIIWUOEL-NSHDSACASA-N |
| XLogP | 0.98 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |