C16H17F2N3O2 — CID 95698018
1-[3-(difluoromethoxy)-2-methylphenyl]-3-[(1S)-1-pyridin-4-ylethyl]urea (PubChem CID 95698018) has the molecular formula C16H17F2N3O2 and a molecular weight of 321.33 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)-2-methylphenyl]-3-[(1S)-1-pyridin-4-ylethyl]urea.
| Compound Name | 1-[3-(difluoromethoxy)-2-methylphenyl]-3-[(1S)-1-pyridin-4-ylethyl]urea |
|---|---|
| PubChem CID | 95698018 |
| Molecular Formula | C16H17F2N3O2 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 1-[3-(difluoromethoxy)-2-methylphenyl]-3-[(1S)-1-pyridin-4-ylethyl]urea |
| SMILES | Cc1c(NC(=O)N[C@@H](C)c2ccncc2)cccc1OC(F)F |
| InChI | InChI=1S/C16H17F2N3O2/c1-10-13(4-3-5-14(10)23-15(17)18)21-16(22)20-11(2)12-6-8-19-9-7-12/h3-9,11,15H,1-2H3,(H2,20,21,22)/t11-/m0/s1 |
| InChIKey | YPPCJCMNSXIAKG-NSHDSACASA-N |
| XLogP | 3.87 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |