C18H20ClFN4O2 — CID 95706094
(2S)-2-(5-chloro-6-oxo-4-piperidin-1-ylpyridazin-1-yl)-N-(3-fluorophenyl)propanamide (PubChem CID 95706094) has the molecular formula C18H20ClFN4O2 and a molecular weight of 378.84 g/mol. Its IUPAC name is (2S)-2-(5-chloro-6-oxo-4-piperidin-1-ylpyridazin-1-yl)-N-(3-fluorophenyl)propanamide.
| Compound Name | (2S)-2-(5-chloro-6-oxo-4-piperidin-1-ylpyridazin-1-yl)-N-(3-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 95706094 |
| Molecular Formula | C18H20ClFN4O2 |
| Molecular Weight | 378.84 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | (2S)-2-(5-chloro-6-oxo-4-piperidin-1-ylpyridazin-1-yl)-N-(3-fluorophenyl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1cccc(F)c1)n1ncc(N2CCCCC2)c(Cl)c1=O |
| InChI | InChI=1S/C18H20ClFN4O2/c1-12(17(25)22-14-7-5-6-13(20)10-14)24-18(26)16(19)15(11-21-24)23-8-3-2-4-9-23/h5-7,10-12H,2-4,8-9H2,1H3,(H,22,25)/t12-/m0/s1 |
| InChIKey | XWZTYVVPSQQKHW-LBPRGKRZSA-N |
| XLogP | 3.23 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.84 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |