C19H23ClN4O2 — CID 95706061
(2R)-2-(5-chloro-6-oxo-4-piperidin-1-ylpyridazin-1-yl)-N-(3-methylphenyl)propanamide (PubChem CID 95706061) has the molecular formula C19H23ClN4O2 and a molecular weight of 374.87 g/mol. Its IUPAC name is (2R)-2-(5-chloro-6-oxo-4-piperidin-1-ylpyridazin-1-yl)-N-(3-methylphenyl)propanamide.
| Compound Name | (2R)-2-(5-chloro-6-oxo-4-piperidin-1-ylpyridazin-1-yl)-N-(3-methylphenyl)propanamide |
|---|---|
| PubChem CID | 95706061 |
| Molecular Formula | C19H23ClN4O2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (2R)-2-(5-chloro-6-oxo-4-piperidin-1-ylpyridazin-1-yl)-N-(3-methylphenyl)propanamide |
| SMILES | Cc1cccc(NC(=O)[C@@H](C)n2ncc(N3CCCCC3)c(Cl)c2=O)c1 |
| InChI | InChI=1S/C19H23ClN4O2/c1-13-7-6-8-15(11-13)22-18(25)14(2)24-19(26)17(20)16(12-21-24)23-9-4-3-5-10-23/h6-8,11-12,14H,3-5,9-10H2,1-2H3,(H,22,25)/t14-/m1/s1 |
| InChIKey | BCAWKBHAFMKHST-CQSZACIVSA-N |
| XLogP | 3.40 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |