C21H23ClN2O — CID 95714688
N-[[1-(4-chlorophenyl)cyclopropyl]methyl]-2-[(3S)-pyrrolidin-3-yl]benzamide (PubChem CID 95714688) has the molecular formula C21H23ClN2O and a molecular weight of 354.88 g/mol. Its IUPAC name is N-[[1-(4-chlorophenyl)cyclopropyl]methyl]-2-[(3S)-pyrrolidin-3-yl]benzamide.
| Compound Name | N-[[1-(4-chlorophenyl)cyclopropyl]methyl]-2-[(3S)-pyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 95714688 |
| Molecular Formula | C21H23ClN2O |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | N-[[1-(4-chlorophenyl)cyclopropyl]methyl]-2-[(3S)-pyrrolidin-3-yl]benzamide |
| SMILES | O=C(NCC1(c2ccc(Cl)cc2)CC1)c1ccccc1[C@@H]1CCNC1 |
| InChI | InChI=1S/C21H23ClN2O/c22-17-7-5-16(6-8-17)21(10-11-21)14-24-20(25)19-4-2-1-3-18(19)15-9-12-23-13-15/h1-8,15,23H,9-14H2,(H,24,25)/t15-/m1/s1 |
| InChIKey | XUIYPFVXJWVCOI-OAHLLOKOSA-N |
| XLogP | 3.88 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |