C14H18N2O4 — CID 95719072
N-(1,3-benzodioxol-5-ylmethyl)-2-[(3S)-morpholin-3-yl]acetamide (PubChem CID 95719072) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[(3S)-morpholin-3-yl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[(3S)-morpholin-3-yl]acetamide |
|---|---|
| PubChem CID | 95719072 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[(3S)-morpholin-3-yl]acetamide |
| SMILES | O=C(C[C@H]1COCCN1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H18N2O4/c17-14(6-11-8-18-4-3-15-11)16-7-10-1-2-12-13(5-10)20-9-19-12/h1-2,5,11,15H,3-4,6-9H2,(H,16,17)/t11-/m0/s1 |
| InChIKey | NTZRZBCNOFZJOH-NSHDSACASA-N |
| XLogP | 0.41 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |