C17H25N5O2 — CID 95728262
(3R)-4-methyl-3-[2-[4-(4-methyl-2-pyridinyl)piperazin-1-yl]-2-oxoethyl]piperazin-2-one (PubChem CID 95728262) has the molecular formula C17H25N5O2 and a molecular weight of 331.42 g/mol. Its IUPAC name is (3R)-4-methyl-3-[2-[4-(4-methyl-2-pyridinyl)piperazin-1-yl]-2-oxoethyl]piperazin-2-one.
| Compound Name | (3R)-4-methyl-3-[2-[4-(4-methyl-2-pyridinyl)piperazin-1-yl]-2-oxoethyl]piperazin-2-one |
|---|---|
| PubChem CID | 95728262 |
| Molecular Formula | C17H25N5O2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | (3R)-4-methyl-3-[2-[4-(4-methyl-2-pyridinyl)piperazin-1-yl]-2-oxoethyl]piperazin-2-one |
| SMILES | Cc1ccnc(N2CCN(C(=O)C[C@@H]3C(=O)NCCN3C)CC2)c1 |
| InChI | InChI=1S/C17H25N5O2/c1-13-3-4-18-15(11-13)21-7-9-22(10-8-21)16(23)12-14-17(24)19-5-6-20(14)2/h3-4,11,14H,5-10,12H2,1-2H3,(H,19,24)/t14-/m1/s1 |
| InChIKey | MWUZPQZLLSRJGX-CQSZACIVSA-N |
| XLogP | -0.14 |
| TPSA | 68.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |