C22H19Cl2NO3 — CID 95733640
N-[4-chloro-2-[(R)-hydroxy(phenyl)methyl]phenyl]-2-(4-chloro-3-methylphenoxy)acetamide (PubChem CID 95733640) has the molecular formula C22H19Cl2NO3 and a molecular weight of 416.30 g/mol. Its IUPAC name is N-[4-chloro-2-[(R)-hydroxy(phenyl)methyl]phenyl]-2-(4-chloro-3-methylphenoxy)acetamide.
| Compound Name | N-[4-chloro-2-[(R)-hydroxy(phenyl)methyl]phenyl]-2-(4-chloro-3-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 95733640 |
| Molecular Formula | C22H19Cl2NO3 |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | N-[4-chloro-2-[(R)-hydroxy(phenyl)methyl]phenyl]-2-(4-chloro-3-methylphenoxy)acetamide |
| SMILES | Cc1cc(OCC(=O)Nc2ccc(Cl)cc2[C@H](O)c2ccccc2)ccc1Cl |
| InChI | InChI=1S/C22H19Cl2NO3/c1-14-11-17(8-9-19(14)24)28-13-21(26)25-20-10-7-16(23)12-18(20)22(27)15-5-3-2-4-6-15/h2-12,22,27H,13H2,1H3,(H,25,26)/t22-/m1/s1 |
| InChIKey | XOTHNGSWTGSCNK-JOCHJYFZSA-N |
| XLogP | 5.40 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |